C15H24ClN3O2S2 — CID 111372383
1-[2-(4-chlorophenyl)sulfanylethyl]-3-ethyl-2-(2-ethylsulfonylethyl)guanidine (PubChem CID 111372383) has the molecular formula C15H24ClN3O2S2 and a molecular weight of 377.96 g/mol. Its IUPAC name is 1-[2-(4-chlorophenyl)sulfanylethyl]-3-ethyl-2-(2-ethylsulfonylethyl)guanidine.
| Compound Name | 1-[2-(4-chlorophenyl)sulfanylethyl]-3-ethyl-2-(2-ethylsulfonylethyl)guanidine |
|---|---|
| PubChem CID | 111372383 |
| Molecular Formula | C15H24ClN3O2S2 |
| Molecular Weight | 377.96 g/mol |
| Exact Mass | 377.10 |
| IUPAC Name | 1-[2-(4-chlorophenyl)sulfanylethyl]-3-ethyl-2-(2-ethylsulfonylethyl)guanidine |
| SMILES | CCN/C(=N\CCS(=O)(=O)CC)NCCSc1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H24ClN3O2S2/c1-3-17-15(19-10-12-23(20,21)4-2)18-9-11-22-14-7-5-13(16)6-8-14/h5-8H,3-4,9-12H2,1-2H3,(H2,17,18,19) |
| InChIKey | CIZRJJQZMPNCMZ-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.96 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|