C16H26ClIN4OS — CID 111372132
3-[[[2-(4-chlorophenyl)sulfanylethylamino]-(ethylamino)methylidene]amino]-N,N-dimethylpropanamide;hydroiodide (PubChem CID 111372132) has the molecular formula C16H26ClIN4OS and a molecular weight of 484.84 g/mol. Its IUPAC name is 3-[[[2-(4-chlorophenyl)sulfanylethylamino]-(ethylamino)methylidene]amino]-N,N-dimethylpropanamide;hydroiodide.
| Compound Name | 3-[[[2-(4-chlorophenyl)sulfanylethylamino]-(ethylamino)methylidene]amino]-N,N-dimethylpropanamide;hydroiodide |
|---|---|
| PubChem CID | 111372132 |
| Molecular Formula | C16H26ClIN4OS |
| Molecular Weight | 484.84 g/mol |
| Exact Mass | 484.06 |
| IUPAC Name | 3-[[[2-(4-chlorophenyl)sulfanylethylamino]-(ethylamino)methylidene]amino]-N,N-dimethylpropanamide;hydroiodide |
| SMILES | CCN/C(=N\CCC(=O)N(C)C)NCCSc1ccc(Cl)cc1.I |
| InChI | InChI=1S/C16H25ClN4OS.HI/c1-4-18-16(19-10-9-15(22)21(2)3)20-11-12-23-14-7-5-13(17)6-8-14;/h5-8H,4,9-12H2,1-3H3,(H2,18,19,20);1H |
| InChIKey | TTYJNQDGQDOHAL-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.84 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|