C13H21ClIN3S — CID 111372090
2-[2-(4-chlorophenyl)sulfanylethyl]-3-ethyl-1,1-dimethylguanidine;hydroiodide (PubChem CID 111372090) has the molecular formula C13H21ClIN3S and a molecular weight of 413.76 g/mol. Its IUPAC name is 2-[2-(4-chlorophenyl)sulfanylethyl]-3-ethyl-1,1-dimethylguanidine;hydroiodide.
| Compound Name | 2-[2-(4-chlorophenyl)sulfanylethyl]-3-ethyl-1,1-dimethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111372090 |
| Molecular Formula | C13H21ClIN3S |
| Molecular Weight | 413.76 g/mol |
| Exact Mass | 413.02 |
| IUPAC Name | 2-[2-(4-chlorophenyl)sulfanylethyl]-3-ethyl-1,1-dimethylguanidine;hydroiodide |
| SMILES | CCN/C(=N/CCSc1ccc(Cl)cc1)N(C)C.I |
| InChI | InChI=1S/C13H20ClN3S.HI/c1-4-15-13(17(2)3)16-9-10-18-12-7-5-11(14)6-8-12;/h5-8H,4,9-10H2,1-3H3,(H,15,16);1H |
| InChIKey | RYTHNVVWDCTGCB-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.76 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|