C19H33N3O2S2 — CID 111987351
2-(2,2-dimethyl-4-methylsulfonylbutyl)-1-ethyl-3-(2-phenylsulfanylpropyl)guanidine (PubChem CID 111987351) has the molecular formula C19H33N3O2S2 and a molecular weight of 399.63 g/mol. Its IUPAC name is 2-(2,2-dimethyl-4-methylsulfonylbutyl)-1-ethyl-3-(2-phenylsulfanylpropyl)guanidine.
| Compound Name | 2-(2,2-dimethyl-4-methylsulfonylbutyl)-1-ethyl-3-(2-phenylsulfanylpropyl)guanidine |
|---|---|
| PubChem CID | 111987351 |
| Molecular Formula | C19H33N3O2S2 |
| Molecular Weight | 399.63 g/mol |
| Exact Mass | 399.20 |
| IUPAC Name | 2-(2,2-dimethyl-4-methylsulfonylbutyl)-1-ethyl-3-(2-phenylsulfanylpropyl)guanidine |
| SMILES | CCN/C(=N\CC(C)(C)CCS(C)(=O)=O)NCC(C)Sc1ccccc1 |
| InChI | InChI=1S/C19H33N3O2S2/c1-6-20-18(22-15-19(3,4)12-13-26(5,23)24)21-14-16(2)25-17-10-8-7-9-11-17/h7-11,16H,6,12-15H2,1-5H3,(H2,20,21,22) |
| InChIKey | TVVFVVCDDZSVQH-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.63 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|