C17H37N3O2S — CID 111773362
2-(2,2-dimethyl-4-methylsulfonylbutyl)-1-ethyl-3-(5-methylhexan-2-yl)guanidine (PubChem CID 111773362) has the molecular formula C17H37N3O2S and a molecular weight of 347.57 g/mol. Its IUPAC name is 2-(2,2-dimethyl-4-methylsulfonylbutyl)-1-ethyl-3-(5-methylhexan-2-yl)guanidine.
| Compound Name | 2-(2,2-dimethyl-4-methylsulfonylbutyl)-1-ethyl-3-(5-methylhexan-2-yl)guanidine |
|---|---|
| PubChem CID | 111773362 |
| Molecular Formula | C17H37N3O2S |
| Molecular Weight | 347.57 g/mol |
| Exact Mass | 347.26 |
| IUPAC Name | 2-(2,2-dimethyl-4-methylsulfonylbutyl)-1-ethyl-3-(5-methylhexan-2-yl)guanidine |
| SMILES | CCN/C(=N\CC(C)(C)CCS(C)(=O)=O)NC(C)CCC(C)C |
| InChI | InChI=1S/C17H37N3O2S/c1-8-18-16(20-15(4)10-9-14(2)3)19-13-17(5,6)11-12-23(7,21)22/h14-15H,8-13H2,1-7H3,(H2,18,19,20) |
| InChIKey | CMADQLLBPFEYHF-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.57 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|