C19H33N3O3S — CID 109409369
2-(2,2-dimethyl-4-methylsulfonylbutyl)-1-ethyl-3-(3-hydroxy-2-phenylpropyl)guanidine (PubChem CID 109409369) has the molecular formula C19H33N3O3S and a molecular weight of 383.56 g/mol. Its IUPAC name is 2-(2,2-dimethyl-4-methylsulfonylbutyl)-1-ethyl-3-(3-hydroxy-2-phenylpropyl)guanidine.
| Compound Name | 2-(2,2-dimethyl-4-methylsulfonylbutyl)-1-ethyl-3-(3-hydroxy-2-phenylpropyl)guanidine |
|---|---|
| PubChem CID | 109409369 |
| Molecular Formula | C19H33N3O3S |
| Molecular Weight | 383.56 g/mol |
| Exact Mass | 383.22 |
| IUPAC Name | 2-(2,2-dimethyl-4-methylsulfonylbutyl)-1-ethyl-3-(3-hydroxy-2-phenylpropyl)guanidine |
| SMILES | CCN/C(=N\CC(C)(C)CCS(C)(=O)=O)NCC(CO)c1ccccc1 |
| InChI | InChI=1S/C19H33N3O3S/c1-5-20-18(22-15-19(2,3)11-12-26(4,24)25)21-13-17(14-23)16-9-7-6-8-10-16/h6-10,17,23H,5,11-15H2,1-4H3,(H2,20,21,22) |
| InChIKey | HXFJWUYEXXLBDK-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 90.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.56 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|