C21H30N4O2S2 — CID 111677184
1-ethyl-2-[[4-(methylsulfamoylmethyl)phenyl]methyl]-3-(2-phenylsulfanylpropyl)guanidine (PubChem CID 111677184) has the molecular formula C21H30N4O2S2 and a molecular weight of 434.63 g/mol. Its IUPAC name is 1-ethyl-2-[[4-(methylsulfamoylmethyl)phenyl]methyl]-3-(2-phenylsulfanylpropyl)guanidine.
| Compound Name | 1-ethyl-2-[[4-(methylsulfamoylmethyl)phenyl]methyl]-3-(2-phenylsulfanylpropyl)guanidine |
|---|---|
| PubChem CID | 111677184 |
| Molecular Formula | C21H30N4O2S2 |
| Molecular Weight | 434.63 g/mol |
| Exact Mass | 434.18 |
| IUPAC Name | 1-ethyl-2-[[4-(methylsulfamoylmethyl)phenyl]methyl]-3-(2-phenylsulfanylpropyl)guanidine |
| SMILES | CCN/C(=N\Cc1ccc(CS(=O)(=O)NC)cc1)NCC(C)Sc1ccccc1 |
| InChI | InChI=1S/C21H30N4O2S2/c1-4-23-21(24-14-17(2)28-20-8-6-5-7-9-20)25-15-18-10-12-19(13-11-18)16-29(26,27)22-3/h5-13,17,22H,4,14-16H2,1-3H3,(H2,23,24,25) |
| InChIKey | QOKOALRVAHZLRS-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 82.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.63 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|