C15H27N5O2S — CID 111782044
1-ethyl-2-[2-(methanesulfonamido)-2-methylpropyl]-3-(2-pyridin-2-ylethyl)guanidine (PubChem CID 111782044) has the molecular formula C15H27N5O2S and a molecular weight of 341.48 g/mol. Its IUPAC name is 1-ethyl-2-[2-(methanesulfonamido)-2-methylpropyl]-3-(2-pyridin-2-ylethyl)guanidine.
| Compound Name | 1-ethyl-2-[2-(methanesulfonamido)-2-methylpropyl]-3-(2-pyridin-2-ylethyl)guanidine |
|---|---|
| PubChem CID | 111782044 |
| Molecular Formula | C15H27N5O2S |
| Molecular Weight | 341.48 g/mol |
| Exact Mass | 341.19 |
| IUPAC Name | 1-ethyl-2-[2-(methanesulfonamido)-2-methylpropyl]-3-(2-pyridin-2-ylethyl)guanidine |
| SMILES | CCN/C(=N\CC(C)(C)NS(C)(=O)=O)NCCc1ccccn1 |
| InChI | InChI=1S/C15H27N5O2S/c1-5-16-14(18-11-9-13-8-6-7-10-17-13)19-12-15(2,3)20-23(4,21)22/h6-8,10,20H,5,9,11-12H2,1-4H3,(H2,16,18,19) |
| InChIKey | PFRZPZDKPTYLJJ-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 95.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.48 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|