C21H30N4 — CID 111192996
1-ethyl-2-[2-methyl-2-(4-methylphenyl)propyl]-3-(2-pyridin-2-ylethyl)guanidine (PubChem CID 111192996) has the molecular formula C21H30N4 and a molecular weight of 338.50 g/mol. Its IUPAC name is 1-ethyl-2-[2-methyl-2-(4-methylphenyl)propyl]-3-(2-pyridin-2-ylethyl)guanidine.
| Compound Name | 1-ethyl-2-[2-methyl-2-(4-methylphenyl)propyl]-3-(2-pyridin-2-ylethyl)guanidine |
|---|---|
| PubChem CID | 111192996 |
| Molecular Formula | C21H30N4 |
| Molecular Weight | 338.50 g/mol |
| Exact Mass | 338.25 |
| IUPAC Name | 1-ethyl-2-[2-methyl-2-(4-methylphenyl)propyl]-3-(2-pyridin-2-ylethyl)guanidine |
| SMILES | CCN/C(=N\CC(C)(C)c1ccc(C)cc1)NCCc1ccccn1 |
| InChI | InChI=1S/C21H30N4/c1-5-22-20(24-15-13-19-8-6-7-14-23-19)25-16-21(3,4)18-11-9-17(2)10-12-18/h6-12,14H,5,13,15-16H2,1-4H3,(H2,22,24,25) |
| InChIKey | DBIYNOGSBMRPJO-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 49.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.50 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|