C23H33N5 — CID 111191666
2-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-methylpropyl]-1-ethyl-3-(2-pyridin-2-ylethyl)guanidine (PubChem CID 111191666) has the molecular formula C23H33N5 and a molecular weight of 379.55 g/mol. Its IUPAC name is 2-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-methylpropyl]-1-ethyl-3-(2-pyridin-2-ylethyl)guanidine.
| Compound Name | 2-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-methylpropyl]-1-ethyl-3-(2-pyridin-2-ylethyl)guanidine |
|---|---|
| PubChem CID | 111191666 |
| Molecular Formula | C23H33N5 |
| Molecular Weight | 379.55 g/mol |
| Exact Mass | 379.27 |
| IUPAC Name | 2-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-methylpropyl]-1-ethyl-3-(2-pyridin-2-ylethyl)guanidine |
| SMILES | CCN/C(=N\CC(C)(C)N1CCc2ccccc2C1)NCCc1ccccn1 |
| InChI | InChI=1S/C23H33N5/c1-4-24-22(26-15-12-21-11-7-8-14-25-21)27-18-23(2,3)28-16-13-19-9-5-6-10-20(19)17-28/h5-11,14H,4,12-13,15-18H2,1-3H3,(H2,24,26,27) |
| InChIKey | GEZZLGYLARBUHF-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 52.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.55 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|