C20H36IN5 — CID 111194343
1-ethyl-2-[2-methyl-2-(3-methylpiperidin-1-yl)propyl]-3-(2-pyridin-2-ylethyl)guanidine;hydroiodide (PubChem CID 111194343) has the molecular formula C20H36IN5 and a molecular weight of 473.45 g/mol. Its IUPAC name is 1-ethyl-2-[2-methyl-2-(3-methylpiperidin-1-yl)propyl]-3-(2-pyridin-2-ylethyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[2-methyl-2-(3-methylpiperidin-1-yl)propyl]-3-(2-pyridin-2-ylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111194343 |
| Molecular Formula | C20H36IN5 |
| Molecular Weight | 473.45 g/mol |
| Exact Mass | 473.20 |
| IUPAC Name | 1-ethyl-2-[2-methyl-2-(3-methylpiperidin-1-yl)propyl]-3-(2-pyridin-2-ylethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(C)(C)N1CCCC(C)C1)NCCc1ccccn1.I |
| InChI | InChI=1S/C20H35N5.HI/c1-5-21-19(23-13-11-18-10-6-7-12-22-18)24-16-20(3,4)25-14-8-9-17(2)15-25;/h6-7,10,12,17H,5,8-9,11,13-16H2,1-4H3,(H2,21,23,24);1H |
| InChIKey | LBCILAPTBBASDO-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 52.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.45 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|