C23H31N5O — CID 111828401
2-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-4-oxobutyl]-1-ethyl-3-(2-pyridin-2-ylethyl)guanidine (PubChem CID 111828401) has the molecular formula C23H31N5O and a molecular weight of 393.54 g/mol. Its IUPAC name is 2-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-4-oxobutyl]-1-ethyl-3-(2-pyridin-2-ylethyl)guanidine.
| Compound Name | 2-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-4-oxobutyl]-1-ethyl-3-(2-pyridin-2-ylethyl)guanidine |
|---|---|
| PubChem CID | 111828401 |
| Molecular Formula | C23H31N5O |
| Molecular Weight | 393.54 g/mol |
| Exact Mass | 393.25 |
| IUPAC Name | 2-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-4-oxobutyl]-1-ethyl-3-(2-pyridin-2-ylethyl)guanidine |
| SMILES | CCN/C(=N\CCCC(=O)N1CCc2ccccc2C1)NCCc1ccccn1 |
| InChI | InChI=1S/C23H31N5O/c1-2-24-23(27-16-12-21-10-5-6-14-25-21)26-15-7-11-22(29)28-17-13-19-8-3-4-9-20(19)18-28/h3-6,8-10,14H,2,7,11-13,15-18H2,1H3,(H2,24,26,27) |
| InChIKey | WUIPJJMGRCRCLX-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.54 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|