C18H25N3OS2 — CID 111654200
1-ethyl-2-(2-hydroxy-2-thiophen-3-ylpropyl)-3-(2-phenylsulfanylethyl)guanidine (PubChem CID 111654200) has the molecular formula C18H25N3OS2 and a molecular weight of 363.55 g/mol. Its IUPAC name is 1-ethyl-2-(2-hydroxy-2-thiophen-3-ylpropyl)-3-(2-phenylsulfanylethyl)guanidine.
| Compound Name | 1-ethyl-2-(2-hydroxy-2-thiophen-3-ylpropyl)-3-(2-phenylsulfanylethyl)guanidine |
|---|---|
| PubChem CID | 111654200 |
| Molecular Formula | C18H25N3OS2 |
| Molecular Weight | 363.55 g/mol |
| Exact Mass | 363.14 |
| IUPAC Name | 1-ethyl-2-(2-hydroxy-2-thiophen-3-ylpropyl)-3-(2-phenylsulfanylethyl)guanidine |
| SMILES | CCN/C(=N\CC(C)(O)c1ccsc1)NCCSc1ccccc1 |
| InChI | InChI=1S/C18H25N3OS2/c1-3-19-17(20-10-12-24-16-7-5-4-6-8-16)21-14-18(2,22)15-9-11-23-13-15/h4-9,11,13,22H,3,10,12,14H2,1-2H3,(H2,19,20,21) |
| InChIKey | AGLMTNCNQIXTGY-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.55 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|