C17H30FIN4O2S2 — CID 111784140
1-ethyl-3-[3-(4-fluorophenyl)sulfanylpropyl]-2-[2-(methanesulfonamido)-2-methylpropyl]guanidine;hydroiodide (PubChem CID 111784140) has the molecular formula C17H30FIN4O2S2 and a molecular weight of 532.49 g/mol. Its IUPAC name is 1-ethyl-3-[3-(4-fluorophenyl)sulfanylpropyl]-2-[2-(methanesulfonamido)-2-methylpropyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[3-(4-fluorophenyl)sulfanylpropyl]-2-[2-(methanesulfonamido)-2-methylpropyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111784140 |
| Molecular Formula | C17H30FIN4O2S2 |
| Molecular Weight | 532.49 g/mol |
| Exact Mass | 532.08 |
| IUPAC Name | 1-ethyl-3-[3-(4-fluorophenyl)sulfanylpropyl]-2-[2-(methanesulfonamido)-2-methylpropyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(C)(C)NS(C)(=O)=O)NCCCSc1ccc(F)cc1.I |
| InChI | InChI=1S/C17H29FN4O2S2.HI/c1-5-19-16(21-13-17(2,3)22-26(4,23)24)20-11-6-12-25-15-9-7-14(18)8-10-15;/h7-10,22H,5-6,11-13H2,1-4H3,(H2,19,20,21);1H |
| InChIKey | ARMGJWSYGPPHAI-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 82.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.49 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|