C19H27FIN3O2S — CID 111515155
1-ethyl-3-[3-(4-fluorophenyl)sulfanylpropyl]-2-[2-(furan-2-yl)-2-hydroxypropyl]guanidine;hydroiodide (PubChem CID 111515155) has the molecular formula C19H27FIN3O2S and a molecular weight of 507.41 g/mol. Its IUPAC name is 1-ethyl-3-[3-(4-fluorophenyl)sulfanylpropyl]-2-[2-(furan-2-yl)-2-hydroxypropyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[3-(4-fluorophenyl)sulfanylpropyl]-2-[2-(furan-2-yl)-2-hydroxypropyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111515155 |
| Molecular Formula | C19H27FIN3O2S |
| Molecular Weight | 507.41 g/mol |
| Exact Mass | 507.09 |
| IUPAC Name | 1-ethyl-3-[3-(4-fluorophenyl)sulfanylpropyl]-2-[2-(furan-2-yl)-2-hydroxypropyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(C)(O)c1ccco1)NCCCSc1ccc(F)cc1.I |
| InChI | InChI=1S/C19H26FN3O2S.HI/c1-3-21-18(23-14-19(2,24)17-6-4-12-25-17)22-11-5-13-26-16-9-7-15(20)8-10-16;/h4,6-10,12,24H,3,5,11,13-14H2,1-2H3,(H2,21,22,23);1H |
| InChIKey | XGCMGFOEIUAVMI-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 69.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.41 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|