C20H33FN4O2S — CID 111657640
1-ethyl-3-[3-(4-fluorophenyl)sulfanylpropyl]-2-(2-hydroxy-2-methyl-3-morpholin-4-ylpropyl)guanidine (PubChem CID 111657640) has the molecular formula C20H33FN4O2S and a molecular weight of 412.58 g/mol. Its IUPAC name is 1-ethyl-3-[3-(4-fluorophenyl)sulfanylpropyl]-2-(2-hydroxy-2-methyl-3-morpholin-4-ylpropyl)guanidine.
| Compound Name | 1-ethyl-3-[3-(4-fluorophenyl)sulfanylpropyl]-2-(2-hydroxy-2-methyl-3-morpholin-4-ylpropyl)guanidine |
|---|---|
| PubChem CID | 111657640 |
| Molecular Formula | C20H33FN4O2S |
| Molecular Weight | 412.58 g/mol |
| Exact Mass | 412.23 |
| IUPAC Name | 1-ethyl-3-[3-(4-fluorophenyl)sulfanylpropyl]-2-(2-hydroxy-2-methyl-3-morpholin-4-ylpropyl)guanidine |
| SMILES | CCN/C(=N\CC(C)(O)CN1CCOCC1)NCCCSc1ccc(F)cc1 |
| InChI | InChI=1S/C20H33FN4O2S/c1-3-22-19(23-9-4-14-28-18-7-5-17(21)6-8-18)24-15-20(2,26)16-25-10-12-27-13-11-25/h5-8,26H,3-4,9-16H2,1-2H3,(H2,22,23,24) |
| InChIKey | BEDRUDMVNRGUPY-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 69.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.58 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|