C19H40N6O2 — CID 111658320
1-ethyl-3-[2-(4-ethylpiperazin-1-yl)ethyl]-2-(2-hydroxy-2-methyl-3-morpholin-4-ylpropyl)guanidine (PubChem CID 111658320) has the molecular formula C19H40N6O2 and a molecular weight of 384.57 g/mol. Its IUPAC name is 1-ethyl-3-[2-(4-ethylpiperazin-1-yl)ethyl]-2-(2-hydroxy-2-methyl-3-morpholin-4-ylpropyl)guanidine.
| Compound Name | 1-ethyl-3-[2-(4-ethylpiperazin-1-yl)ethyl]-2-(2-hydroxy-2-methyl-3-morpholin-4-ylpropyl)guanidine |
|---|---|
| PubChem CID | 111658320 |
| Molecular Formula | C19H40N6O2 |
| Molecular Weight | 384.57 g/mol |
| Exact Mass | 384.32 |
| IUPAC Name | 1-ethyl-3-[2-(4-ethylpiperazin-1-yl)ethyl]-2-(2-hydroxy-2-methyl-3-morpholin-4-ylpropyl)guanidine |
| SMILES | CCN/C(=N\CC(C)(O)CN1CCOCC1)NCCN1CCN(CC)CC1 |
| InChI | InChI=1S/C19H40N6O2/c1-4-20-18(21-6-7-24-10-8-23(5-2)9-11-24)22-16-19(3,26)17-25-12-14-27-15-13-25/h26H,4-17H2,1-3H3,(H2,20,21,22) |
| InChIKey | ZILGWKDWVXFRRZ-UHFFFAOYSA-N |
| XLogP | -0.74 |
| TPSA | 75.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.57 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|