C22H45N5O2 — CID 111657862
1-[4-(3,5-dimethylpiperidin-1-yl)butyl]-3-ethyl-2-(2-hydroxy-2-methyl-3-morpholin-4-ylpropyl)guanidine (PubChem CID 111657862) has the molecular formula C22H45N5O2 and a molecular weight of 411.64 g/mol. Its IUPAC name is 1-[4-(3,5-dimethylpiperidin-1-yl)butyl]-3-ethyl-2-(2-hydroxy-2-methyl-3-morpholin-4-ylpropyl)guanidine.
| Compound Name | 1-[4-(3,5-dimethylpiperidin-1-yl)butyl]-3-ethyl-2-(2-hydroxy-2-methyl-3-morpholin-4-ylpropyl)guanidine |
|---|---|
| PubChem CID | 111657862 |
| Molecular Formula | C22H45N5O2 |
| Molecular Weight | 411.64 g/mol |
| Exact Mass | 411.36 |
| IUPAC Name | 1-[4-(3,5-dimethylpiperidin-1-yl)butyl]-3-ethyl-2-(2-hydroxy-2-methyl-3-morpholin-4-ylpropyl)guanidine |
| SMILES | CCN/C(=N\CC(C)(O)CN1CCOCC1)NCCCCN1CC(C)CC(C)C1 |
| InChI | InChI=1S/C22H45N5O2/c1-5-23-21(25-17-22(4,28)18-26-10-12-29-13-11-26)24-8-6-7-9-27-15-19(2)14-20(3)16-27/h19-20,28H,5-18H2,1-4H3,(H2,23,24,25) |
| InChIKey | NEQXEBBXWSAWGU-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 72.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.64 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|