C15H31IN4O2 — CID 111657763
1-ethyl-2-(2-hydroxy-2-methyl-3-morpholin-4-ylpropyl)-3-(2-methylcyclopropyl)guanidine;hydroiodide (PubChem CID 111657763) has the molecular formula C15H31IN4O2 and a molecular weight of 426.34 g/mol. Its IUPAC name is 1-ethyl-2-(2-hydroxy-2-methyl-3-morpholin-4-ylpropyl)-3-(2-methylcyclopropyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-(2-hydroxy-2-methyl-3-morpholin-4-ylpropyl)-3-(2-methylcyclopropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111657763 |
| Molecular Formula | C15H31IN4O2 |
| Molecular Weight | 426.34 g/mol |
| Exact Mass | 426.15 |
| IUPAC Name | 1-ethyl-2-(2-hydroxy-2-methyl-3-morpholin-4-ylpropyl)-3-(2-methylcyclopropyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(C)(O)CN1CCOCC1)NC1CC1C.I |
| InChI | InChI=1S/C15H30N4O2.HI/c1-4-16-14(18-13-9-12(13)2)17-10-15(3,20)11-19-5-7-21-8-6-19;/h12-13,20H,4-11H2,1-3H3,(H2,16,17,18);1H |
| InChIKey | KNZJLWGNGMKLAN-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 69.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.34 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|