C18H37N5O4S — CID 111657412
1-ethyl-2-(2-hydroxy-2-methyl-3-morpholin-4-ylpropyl)-3-[(1-methylsulfonylpiperidin-4-yl)methyl]guanidine (PubChem CID 111657412) has the molecular formula C18H37N5O4S and a molecular weight of 419.59 g/mol. Its IUPAC name is 1-ethyl-2-(2-hydroxy-2-methyl-3-morpholin-4-ylpropyl)-3-[(1-methylsulfonylpiperidin-4-yl)methyl]guanidine.
| Compound Name | 1-ethyl-2-(2-hydroxy-2-methyl-3-morpholin-4-ylpropyl)-3-[(1-methylsulfonylpiperidin-4-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111657412 |
| Molecular Formula | C18H37N5O4S |
| Molecular Weight | 419.59 g/mol |
| Exact Mass | 419.26 |
| IUPAC Name | 1-ethyl-2-(2-hydroxy-2-methyl-3-morpholin-4-ylpropyl)-3-[(1-methylsulfonylpiperidin-4-yl)methyl]guanidine |
| SMILES | CCN/C(=N\CC(C)(O)CN1CCOCC1)NCC1CCN(S(C)(=O)=O)CC1 |
| InChI | InChI=1S/C18H37N5O4S/c1-4-19-17(20-13-16-5-7-23(8-6-16)28(3,25)26)21-14-18(2,24)15-22-9-11-27-12-10-22/h16,24H,4-15H2,1-3H3,(H2,19,20,21) |
| InChIKey | JKKNKEWNJBQUQJ-UHFFFAOYSA-N |
| XLogP | -0.70 |
| TPSA | 106.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.59 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|