C22H43N5O4 — CID 111658132
tert-butyl 3-[[[N-ethyl-N'-(2-hydroxy-2-methyl-3-morpholin-4-ylpropyl)carbamimidoyl]amino]methyl]piperidine-1-carboxylate (PubChem CID 111658132) has the molecular formula C22H43N5O4 and a molecular weight of 441.62 g/mol. Its IUPAC name is tert-butyl 3-[[[N-ethyl-N'-(2-hydroxy-2-methyl-3-morpholin-4-ylpropyl)carbamimidoyl]amino]methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[[[N-ethyl-N'-(2-hydroxy-2-methyl-3-morpholin-4-ylpropyl)carbamimidoyl]amino]methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 111658132 |
| Molecular Formula | C22H43N5O4 |
| Molecular Weight | 441.62 g/mol |
| Exact Mass | 441.33 |
| IUPAC Name | tert-butyl 3-[[[N-ethyl-N'-(2-hydroxy-2-methyl-3-morpholin-4-ylpropyl)carbamimidoyl]amino]methyl]piperidine-1-carboxylate |
| SMILES | CCN/C(=N\CC(C)(O)CN1CCOCC1)NCC1CCCN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C22H43N5O4/c1-6-23-19(25-16-22(5,29)17-26-10-12-30-13-11-26)24-14-18-8-7-9-27(15-18)20(28)31-21(2,3)4/h18,29H,6-17H2,1-5H3,(H2,23,24,25) |
| InChIKey | JDGDMAFIARELFT-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.62 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|