C20H33N5O2 — CID 110968078
tert-butyl 3-[[[N-ethyl-N'-(pyridin-2-ylmethyl)carbamimidoyl]amino]methyl]piperidine-1-carboxylate (PubChem CID 110968078) has the molecular formula C20H33N5O2 and a molecular weight of 375.52 g/mol. Its IUPAC name is tert-butyl 3-[[[N-ethyl-N'-(pyridin-2-ylmethyl)carbamimidoyl]amino]methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[[[N-ethyl-N'-(pyridin-2-ylmethyl)carbamimidoyl]amino]methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 110968078 |
| Molecular Formula | C20H33N5O2 |
| Molecular Weight | 375.52 g/mol |
| Exact Mass | 375.26 |
| IUPAC Name | tert-butyl 3-[[[N-ethyl-N'-(pyridin-2-ylmethyl)carbamimidoyl]amino]methyl]piperidine-1-carboxylate |
| SMILES | CCN/C(=N\Cc1ccccn1)NCC1CCCN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C20H33N5O2/c1-5-21-18(24-14-17-10-6-7-11-22-17)23-13-16-9-8-12-25(15-16)19(26)27-20(2,3)4/h6-7,10-11,16H,5,8-9,12-15H2,1-4H3,(H2,21,23,24) |
| InChIKey | HWGIYXUVCZEAJY-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 78.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.52 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|