C22H38N4O4 — CID 111663979
tert-butyl 3-[[[N-ethyl-N'-[2-hydroxy-2-(5-methylfuran-2-yl)propyl]carbamimidoyl]amino]methyl]piperidine-1-carboxylate (PubChem CID 111663979) has the molecular formula C22H38N4O4 and a molecular weight of 422.57 g/mol. Its IUPAC name is tert-butyl 3-[[[N-ethyl-N'-[2-hydroxy-2-(5-methylfuran-2-yl)propyl]carbamimidoyl]amino]methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[[[N-ethyl-N'-[2-hydroxy-2-(5-methylfuran-2-yl)propyl]carbamimidoyl]amino]methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 111663979 |
| Molecular Formula | C22H38N4O4 |
| Molecular Weight | 422.57 g/mol |
| Exact Mass | 422.29 |
| IUPAC Name | tert-butyl 3-[[[N-ethyl-N'-[2-hydroxy-2-(5-methylfuran-2-yl)propyl]carbamimidoyl]amino]methyl]piperidine-1-carboxylate |
| SMILES | CCN/C(=N\CC(C)(O)c1ccc(C)o1)NCC1CCCN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C22H38N4O4/c1-7-23-19(25-15-22(6,28)18-11-10-16(2)29-18)24-13-17-9-8-12-26(14-17)20(27)30-21(3,4)5/h10-11,17,28H,7-9,12-15H2,1-6H3,(H2,23,24,25) |
| InChIKey | PZAFVPFNIRDEMP-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 99.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.57 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|