C19H39IN4O3 — CID 111607288
tert-butyl 3-[[[N-ethyl-N'-(2-methoxy-2-methylpropyl)carbamimidoyl]amino]methyl]piperidine-1-carboxylate;hydroiodide (PubChem CID 111607288) has the molecular formula C19H39IN4O3 and a molecular weight of 498.45 g/mol. Its IUPAC name is tert-butyl 3-[[[N-ethyl-N'-(2-methoxy-2-methylpropyl)carbamimidoyl]amino]methyl]piperidine-1-carboxylate;hydroiodide.
| Compound Name | tert-butyl 3-[[[N-ethyl-N'-(2-methoxy-2-methylpropyl)carbamimidoyl]amino]methyl]piperidine-1-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111607288 |
| Molecular Formula | C19H39IN4O3 |
| Molecular Weight | 498.45 g/mol |
| Exact Mass | 498.21 |
| IUPAC Name | tert-butyl 3-[[[N-ethyl-N'-(2-methoxy-2-methylpropyl)carbamimidoyl]amino]methyl]piperidine-1-carboxylate;hydroiodide |
| SMILES | CCN/C(=N\CC(C)(C)OC)NCC1CCCN(C(=O)OC(C)(C)C)C1.I |
| InChI | InChI=1S/C19H38N4O3.HI/c1-8-20-16(22-14-19(5,6)25-7)21-12-15-10-9-11-23(13-15)17(24)26-18(2,3)4;/h15H,8-14H2,1-7H3,(H2,20,21,22);1H |
| InChIKey | MBRVXGOWGVVSJI-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.45 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|