C21H41N5O4 — CID 111657582
tert-butyl N-cyclopropyl-N-[2-[[N-ethyl-N'-(2-hydroxy-2-methyl-3-morpholin-4-ylpropyl)carbamimidoyl]amino]ethyl]carbamate (PubChem CID 111657582) has the molecular formula C21H41N5O4 and a molecular weight of 427.59 g/mol. Its IUPAC name is tert-butyl N-cyclopropyl-N-[2-[[N-ethyl-N'-(2-hydroxy-2-methyl-3-morpholin-4-ylpropyl)carbamimidoyl]amino]ethyl]carbamate.
| Compound Name | tert-butyl N-cyclopropyl-N-[2-[[N-ethyl-N'-(2-hydroxy-2-methyl-3-morpholin-4-ylpropyl)carbamimidoyl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 111657582 |
| Molecular Formula | C21H41N5O4 |
| Molecular Weight | 427.59 g/mol |
| Exact Mass | 427.32 |
| IUPAC Name | tert-butyl N-cyclopropyl-N-[2-[[N-ethyl-N'-(2-hydroxy-2-methyl-3-morpholin-4-ylpropyl)carbamimidoyl]amino]ethyl]carbamate |
| SMILES | CCN/C(=N\CC(C)(O)CN1CCOCC1)NCCN(C(=O)OC(C)(C)C)C1CC1 |
| InChI | InChI=1S/C21H41N5O4/c1-6-22-18(24-15-21(5,28)16-25-11-13-29-14-12-25)23-9-10-26(17-7-8-17)19(27)30-20(2,3)4/h17,28H,6-16H2,1-5H3,(H2,22,23,24) |
| InChIKey | GOUSHZZUEDRSFB-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.59 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|