C22H43IN4O4 — CID 111643027
tert-butyl N-cyclopropyl-N-[2-[[N-ethyl-N'-[3-(oxan-4-ylmethoxy)propyl]carbamimidoyl]amino]ethyl]carbamate;hydroiodide (PubChem CID 111643027) has the molecular formula C22H43IN4O4 and a molecular weight of 554.51 g/mol. Its IUPAC name is tert-butyl N-cyclopropyl-N-[2-[[N-ethyl-N'-[3-(oxan-4-ylmethoxy)propyl]carbamimidoyl]amino]ethyl]carbamate;hydroiodide.
| Compound Name | tert-butyl N-cyclopropyl-N-[2-[[N-ethyl-N'-[3-(oxan-4-ylmethoxy)propyl]carbamimidoyl]amino]ethyl]carbamate;hydroiodide |
|---|---|
| PubChem CID | 111643027 |
| Molecular Formula | C22H43IN4O4 |
| Molecular Weight | 554.51 g/mol |
| Exact Mass | 554.23 |
| IUPAC Name | tert-butyl N-cyclopropyl-N-[2-[[N-ethyl-N'-[3-(oxan-4-ylmethoxy)propyl]carbamimidoyl]amino]ethyl]carbamate;hydroiodide |
| SMILES | CCN/C(=N\CCCOCC1CCOCC1)NCCN(C(=O)OC(C)(C)C)C1CC1.I |
| InChI | InChI=1S/C22H42N4O4.HI/c1-5-23-20(24-11-6-14-29-17-18-9-15-28-16-10-18)25-12-13-26(19-7-8-19)21(27)30-22(2,3)4;/h18-19H,5-17H2,1-4H3,(H2,23,24,25);1H |
| InChIKey | NBDVOQYQBXTNSM-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.51 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|