C15H32IN3O4S — CID 111642653
1-ethyl-3-(2-methylsulfonylethyl)-2-[3-(oxan-4-ylmethoxy)propyl]guanidine;hydroiodide (PubChem CID 111642653) has the molecular formula C15H32IN3O4S and a molecular weight of 477.41 g/mol. Its IUPAC name is 1-ethyl-3-(2-methylsulfonylethyl)-2-[3-(oxan-4-ylmethoxy)propyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-(2-methylsulfonylethyl)-2-[3-(oxan-4-ylmethoxy)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111642653 |
| Molecular Formula | C15H32IN3O4S |
| Molecular Weight | 477.41 g/mol |
| Exact Mass | 477.12 |
| IUPAC Name | 1-ethyl-3-(2-methylsulfonylethyl)-2-[3-(oxan-4-ylmethoxy)propyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCCOCC1CCOCC1)NCCS(C)(=O)=O.I |
| InChI | InChI=1S/C15H31N3O4S.HI/c1-3-16-15(18-8-12-23(2,19)20)17-7-4-9-22-13-14-5-10-21-11-6-14;/h14H,3-13H2,1-2H3,(H2,16,17,18);1H |
| InChIKey | NNGRXMWTTIJTNZ-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.41 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|