C21H42N4O3 — CID 111642986
1-[3-(2,6-dimethylmorpholin-4-yl)propyl]-3-ethyl-2-[3-(oxan-4-ylmethoxy)propyl]guanidine (PubChem CID 111642986) has the molecular formula C21H42N4O3 and a molecular weight of 398.59 g/mol. Its IUPAC name is 1-[3-(2,6-dimethylmorpholin-4-yl)propyl]-3-ethyl-2-[3-(oxan-4-ylmethoxy)propyl]guanidine.
| Compound Name | 1-[3-(2,6-dimethylmorpholin-4-yl)propyl]-3-ethyl-2-[3-(oxan-4-ylmethoxy)propyl]guanidine |
|---|---|
| PubChem CID | 111642986 |
| Molecular Formula | C21H42N4O3 |
| Molecular Weight | 398.59 g/mol |
| Exact Mass | 398.33 |
| IUPAC Name | 1-[3-(2,6-dimethylmorpholin-4-yl)propyl]-3-ethyl-2-[3-(oxan-4-ylmethoxy)propyl]guanidine |
| SMILES | CCN/C(=N\CCCOCC1CCOCC1)NCCCN1CC(C)OC(C)C1 |
| InChI | InChI=1S/C21H42N4O3/c1-4-22-21(23-9-5-11-25-15-18(2)28-19(3)16-25)24-10-6-12-27-17-20-7-13-26-14-8-20/h18-20H,4-17H2,1-3H3,(H2,22,23,24) |
| InChIKey | XNTUPNNZRKJSGU-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.59 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|