C17H23FN4O2S3 — CID 111310804
1-ethyl-3-[3-(4-fluorophenyl)sulfanylpropyl]-2-[(5-sulfamoylthiophen-2-yl)methyl]guanidine (PubChem CID 111310804) has the molecular formula C17H23FN4O2S3 and a molecular weight of 430.60 g/mol. Its IUPAC name is 1-ethyl-3-[3-(4-fluorophenyl)sulfanylpropyl]-2-[(5-sulfamoylthiophen-2-yl)methyl]guanidine.
| Compound Name | 1-ethyl-3-[3-(4-fluorophenyl)sulfanylpropyl]-2-[(5-sulfamoylthiophen-2-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111310804 |
| Molecular Formula | C17H23FN4O2S3 |
| Molecular Weight | 430.60 g/mol |
| Exact Mass | 430.10 |
| IUPAC Name | 1-ethyl-3-[3-(4-fluorophenyl)sulfanylpropyl]-2-[(5-sulfamoylthiophen-2-yl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccc(S(N)(=O)=O)s1)NCCCSc1ccc(F)cc1 |
| InChI | InChI=1S/C17H23FN4O2S3/c1-2-20-17(22-12-15-8-9-16(26-15)27(19,23)24)21-10-3-11-25-14-6-4-13(18)5-7-14/h4-9H,2-3,10-12H2,1H3,(H2,19,23,24)(H2,20,21,22) |
| InChIKey | GMQGCNWMIUWNQN-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 96.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.60 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|