C19H23ClN4O — CID 111358334
2-[[[2-(3-chlorophenyl)ethylamino]-(ethylamino)methylidene]amino]-N-phenylacetamide (PubChem CID 111358334) has the molecular formula C19H23ClN4O and a molecular weight of 358.87 g/mol. Its IUPAC name is 2-[[[2-(3-chlorophenyl)ethylamino]-(ethylamino)methylidene]amino]-N-phenylacetamide.
| Compound Name | 2-[[[2-(3-chlorophenyl)ethylamino]-(ethylamino)methylidene]amino]-N-phenylacetamide |
|---|---|
| PubChem CID | 111358334 |
| Molecular Formula | C19H23ClN4O |
| Molecular Weight | 358.87 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | 2-[[[2-(3-chlorophenyl)ethylamino]-(ethylamino)methylidene]amino]-N-phenylacetamide |
| SMILES | CCN/C(=N\CC(=O)Nc1ccccc1)NCCc1cccc(Cl)c1 |
| InChI | InChI=1S/C19H23ClN4O/c1-2-21-19(22-12-11-15-7-6-8-16(20)13-15)23-14-18(25)24-17-9-4-3-5-10-17/h3-10,13H,2,11-12,14H2,1H3,(H,24,25)(H2,21,22,23) |
| InChIKey | RESBFEVSZLNXPO-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.87 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|