C18H22ClN5O — CID 111196132
2-[[[2-(4-chlorophenyl)ethylamino]-(ethylamino)methylidene]amino]-N-pyridin-3-ylacetamide (PubChem CID 111196132) has the molecular formula C18H22ClN5O and a molecular weight of 359.86 g/mol. Its IUPAC name is 2-[[[2-(4-chlorophenyl)ethylamino]-(ethylamino)methylidene]amino]-N-pyridin-3-ylacetamide.
| Compound Name | 2-[[[2-(4-chlorophenyl)ethylamino]-(ethylamino)methylidene]amino]-N-pyridin-3-ylacetamide |
|---|---|
| PubChem CID | 111196132 |
| Molecular Formula | C18H22ClN5O |
| Molecular Weight | 359.86 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | 2-[[[2-(4-chlorophenyl)ethylamino]-(ethylamino)methylidene]amino]-N-pyridin-3-ylacetamide |
| SMILES | CCN/C(=N\CC(=O)Nc1cccnc1)NCCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H22ClN5O/c1-2-21-18(22-11-9-14-5-7-15(19)8-6-14)23-13-17(25)24-16-4-3-10-20-12-16/h3-8,10,12H,2,9,11,13H2,1H3,(H,24,25)(H2,21,22,23) |
| InChIKey | VHENZXZMIZNLFB-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 78.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.86 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|