C20H23FN6O — CID 111889163
2-[[ethylamino-[2-(6-fluoro-1H-indol-3-yl)ethylamino]methylidene]amino]-N-pyridin-3-ylacetamide (PubChem CID 111889163) has the molecular formula C20H23FN6O and a molecular weight of 382.44 g/mol. Its IUPAC name is 2-[[ethylamino-[2-(6-fluoro-1H-indol-3-yl)ethylamino]methylidene]amino]-N-pyridin-3-ylacetamide.
| Compound Name | 2-[[ethylamino-[2-(6-fluoro-1H-indol-3-yl)ethylamino]methylidene]amino]-N-pyridin-3-ylacetamide |
|---|---|
| PubChem CID | 111889163 |
| Molecular Formula | C20H23FN6O |
| Molecular Weight | 382.44 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | 2-[[ethylamino-[2-(6-fluoro-1H-indol-3-yl)ethylamino]methylidene]amino]-N-pyridin-3-ylacetamide |
| SMILES | CCN/C(=N\CC(=O)Nc1cccnc1)NCCc1c[nH]c2cc(F)ccc12 |
| InChI | InChI=1S/C20H23FN6O/c1-2-23-20(26-13-19(28)27-16-4-3-8-22-12-16)24-9-7-14-11-25-18-10-15(21)5-6-17(14)18/h3-6,8,10-12,25H,2,7,9,13H2,1H3,(H,27,28)(H2,23,24,26) |
| InChIKey | XMCXCNHXXDRZCT-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 94.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.44 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|