C21H25N7O — CID 111864634
2-[[ethylamino-[2-(4-pyrazol-1-ylphenyl)ethylamino]methylidene]amino]-N-pyridin-3-ylacetamide (PubChem CID 111864634) has the molecular formula C21H25N7O and a molecular weight of 391.48 g/mol. Its IUPAC name is 2-[[ethylamino-[2-(4-pyrazol-1-ylphenyl)ethylamino]methylidene]amino]-N-pyridin-3-ylacetamide.
| Compound Name | 2-[[ethylamino-[2-(4-pyrazol-1-ylphenyl)ethylamino]methylidene]amino]-N-pyridin-3-ylacetamide |
|---|---|
| PubChem CID | 111864634 |
| Molecular Formula | C21H25N7O |
| Molecular Weight | 391.48 g/mol |
| Exact Mass | 391.21 |
| IUPAC Name | 2-[[ethylamino-[2-(4-pyrazol-1-ylphenyl)ethylamino]methylidene]amino]-N-pyridin-3-ylacetamide |
| SMILES | CCN/C(=N\CC(=O)Nc1cccnc1)NCCc1ccc(-n2cccn2)cc1 |
| InChI | InChI=1S/C21H25N7O/c1-2-23-21(25-16-20(29)27-18-5-3-11-22-15-18)24-13-10-17-6-8-19(9-7-17)28-14-4-12-26-28/h3-9,11-12,14-15H,2,10,13,16H2,1H3,(H,27,29)(H2,23,24,25) |
| InChIKey | PDNUDXNINRZDON-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 96.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.48 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|