C24H30N6O — CID 111863846
2-[[ethylamino-[2-(4-pyrazol-1-ylphenyl)ethylamino]methylidene]amino]-N-(2-phenylethyl)acetamide (PubChem CID 111863846) has the molecular formula C24H30N6O and a molecular weight of 418.55 g/mol. Its IUPAC name is 2-[[ethylamino-[2-(4-pyrazol-1-ylphenyl)ethylamino]methylidene]amino]-N-(2-phenylethyl)acetamide.
| Compound Name | 2-[[ethylamino-[2-(4-pyrazol-1-ylphenyl)ethylamino]methylidene]amino]-N-(2-phenylethyl)acetamide |
|---|---|
| PubChem CID | 111863846 |
| Molecular Formula | C24H30N6O |
| Molecular Weight | 418.55 g/mol |
| Exact Mass | 418.25 |
| IUPAC Name | 2-[[ethylamino-[2-(4-pyrazol-1-ylphenyl)ethylamino]methylidene]amino]-N-(2-phenylethyl)acetamide |
| SMILES | CCN/C(=N\CC(=O)NCCc1ccccc1)NCCc1ccc(-n2cccn2)cc1 |
| InChI | InChI=1S/C24H30N6O/c1-2-25-24(28-19-23(31)26-16-13-20-7-4-3-5-8-20)27-17-14-21-9-11-22(12-10-21)30-18-6-15-29-30/h3-12,15,18H,2,13-14,16-17,19H2,1H3,(H,26,31)(H2,25,27,28) |
| InChIKey | INERXKZEIUQZKW-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 83.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.55 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|