C14H20F3IN4O — CID 109473614
2-[[ethylamino-(3,3,3-trifluoropropylamino)methylidene]amino]-N-phenylacetamide;hydroiodide (PubChem CID 109473614) has the molecular formula C14H20F3IN4O and a molecular weight of 444.24 g/mol. Its IUPAC name is 2-[[ethylamino-(3,3,3-trifluoropropylamino)methylidene]amino]-N-phenylacetamide;hydroiodide.
| Compound Name | 2-[[ethylamino-(3,3,3-trifluoropropylamino)methylidene]amino]-N-phenylacetamide;hydroiodide |
|---|---|
| PubChem CID | 109473614 |
| Molecular Formula | C14H20F3IN4O |
| Molecular Weight | 444.24 g/mol |
| Exact Mass | 444.06 |
| IUPAC Name | 2-[[ethylamino-(3,3,3-trifluoropropylamino)methylidene]amino]-N-phenylacetamide;hydroiodide |
| SMILES | CCN/C(=N\CC(=O)Nc1ccccc1)NCCC(F)(F)F.I |
| InChI | InChI=1S/C14H19F3N4O.HI/c1-2-18-13(19-9-8-14(15,16)17)20-10-12(22)21-11-6-4-3-5-7-11;/h3-7H,2,8-10H2,1H3,(H,21,22)(H2,18,19,20);1H |
| InChIKey | VFFDKNHJGJLWMN-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.24 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|