C10H19F3N4O — CID 109471873
N-ethyl-2-[[ethylamino-(3,3,3-trifluoropropylamino)methylidene]amino]acetamide (PubChem CID 109471873) has the molecular formula C10H19F3N4O and a molecular weight of 268.28 g/mol. Its IUPAC name is N-ethyl-2-[[ethylamino-(3,3,3-trifluoropropylamino)methylidene]amino]acetamide.
| Compound Name | N-ethyl-2-[[ethylamino-(3,3,3-trifluoropropylamino)methylidene]amino]acetamide |
|---|---|
| PubChem CID | 109471873 |
| Molecular Formula | C10H19F3N4O |
| Molecular Weight | 268.28 g/mol |
| Exact Mass | 268.15 |
| IUPAC Name | N-ethyl-2-[[ethylamino-(3,3,3-trifluoropropylamino)methylidene]amino]acetamide |
| SMILES | CCNC(=O)C/N=C(\NCC)NCCC(F)(F)F |
| InChI | InChI=1S/C10H19F3N4O/c1-3-14-8(18)7-17-9(15-4-2)16-6-5-10(11,12)13/h3-7H2,1-2H3,(H,14,18)(H2,15,16,17) |
| InChIKey | SKXJNSIPOIXOJK-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.28 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|