C22H33N3O4 — CID 111513312
1-[2-(3,4-diethoxyphenyl)ethyl]-3-ethyl-2-[2-(furan-2-yl)-2-hydroxypropyl]guanidine (PubChem CID 111513312) has the molecular formula C22H33N3O4 and a molecular weight of 403.52 g/mol. Its IUPAC name is 1-[2-(3,4-diethoxyphenyl)ethyl]-3-ethyl-2-[2-(furan-2-yl)-2-hydroxypropyl]guanidine.
| Compound Name | 1-[2-(3,4-diethoxyphenyl)ethyl]-3-ethyl-2-[2-(furan-2-yl)-2-hydroxypropyl]guanidine |
|---|---|
| PubChem CID | 111513312 |
| Molecular Formula | C22H33N3O4 |
| Molecular Weight | 403.52 g/mol |
| Exact Mass | 403.25 |
| IUPAC Name | 1-[2-(3,4-diethoxyphenyl)ethyl]-3-ethyl-2-[2-(furan-2-yl)-2-hydroxypropyl]guanidine |
| SMILES | CCN/C(=N\CC(C)(O)c1ccco1)NCCc1ccc(OCC)c(OCC)c1 |
| InChI | InChI=1S/C22H33N3O4/c1-5-23-21(25-16-22(4,26)20-9-8-14-29-20)24-13-12-17-10-11-18(27-6-2)19(15-17)28-7-3/h8-11,14-15,26H,5-7,12-13,16H2,1-4H3,(H2,23,24,25) |
| InChIKey | PIPOSYMOLAENLK-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 88.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.52 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|