C18H24BrFIN3O2 — CID 111672087
1-[2-(3-bromo-4-fluorophenyl)ethyl]-3-ethyl-2-[2-(furan-2-yl)-2-hydroxypropyl]guanidine;hydroiodide (PubChem CID 111672087) has the molecular formula C18H24BrFIN3O2 and a molecular weight of 540.22 g/mol. Its IUPAC name is 1-[2-(3-bromo-4-fluorophenyl)ethyl]-3-ethyl-2-[2-(furan-2-yl)-2-hydroxypropyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(3-bromo-4-fluorophenyl)ethyl]-3-ethyl-2-[2-(furan-2-yl)-2-hydroxypropyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111672087 |
| Molecular Formula | C18H24BrFIN3O2 |
| Molecular Weight | 540.22 g/mol |
| Exact Mass | 539.01 |
| IUPAC Name | 1-[2-(3-bromo-4-fluorophenyl)ethyl]-3-ethyl-2-[2-(furan-2-yl)-2-hydroxypropyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(C)(O)c1ccco1)NCCc1ccc(F)c(Br)c1.I |
| InChI | InChI=1S/C18H23BrFN3O2.HI/c1-3-21-17(23-12-18(2,24)16-5-4-10-25-16)22-9-8-13-6-7-15(20)14(19)11-13;/h4-7,10-11,24H,3,8-9,12H2,1-2H3,(H2,21,22,23);1H |
| InChIKey | MSZNXFBUYUJXMC-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 69.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.22 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|