C15H21BrFN3 — CID 111868450
1-[2-(3-bromo-4-fluorophenyl)ethyl]-2-(cyclopropylmethyl)-3-ethylguanidine (PubChem CID 111868450) has the molecular formula C15H21BrFN3 and a molecular weight of 342.26 g/mol. Its IUPAC name is 1-[2-(3-bromo-4-fluorophenyl)ethyl]-2-(cyclopropylmethyl)-3-ethylguanidine.
| Compound Name | 1-[2-(3-bromo-4-fluorophenyl)ethyl]-2-(cyclopropylmethyl)-3-ethylguanidine |
|---|---|
| PubChem CID | 111868450 |
| Molecular Formula | C15H21BrFN3 |
| Molecular Weight | 342.26 g/mol |
| Exact Mass | 341.09 |
| IUPAC Name | 1-[2-(3-bromo-4-fluorophenyl)ethyl]-2-(cyclopropylmethyl)-3-ethylguanidine |
| SMILES | CCN/C(=N\CC1CC1)NCCc1ccc(F)c(Br)c1 |
| InChI | InChI=1S/C15H21BrFN3/c1-2-18-15(20-10-12-3-4-12)19-8-7-11-5-6-14(17)13(16)9-11/h5-6,9,12H,2-4,7-8,10H2,1H3,(H2,18,19,20) |
| InChIKey | VVWJULZEWIZPFH-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.26 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|