C21H27BrFIN4O — CID 111633933
3-[2-[[N'-[2-(3-bromo-4-fluorophenyl)ethyl]-N-ethylcarbamimidoyl]amino]ethyl]-N-methylbenzamide;hydroiodide (PubChem CID 111633933) has the molecular formula C21H27BrFIN4O and a molecular weight of 577.28 g/mol. Its IUPAC name is 3-[2-[[N'-[2-(3-bromo-4-fluorophenyl)ethyl]-N-ethylcarbamimidoyl]amino]ethyl]-N-methylbenzamide;hydroiodide.
| Compound Name | 3-[2-[[N'-[2-(3-bromo-4-fluorophenyl)ethyl]-N-ethylcarbamimidoyl]amino]ethyl]-N-methylbenzamide;hydroiodide |
|---|---|
| PubChem CID | 111633933 |
| Molecular Formula | C21H27BrFIN4O |
| Molecular Weight | 577.28 g/mol |
| Exact Mass | 576.04 |
| IUPAC Name | 3-[2-[[N'-[2-(3-bromo-4-fluorophenyl)ethyl]-N-ethylcarbamimidoyl]amino]ethyl]-N-methylbenzamide;hydroiodide |
| SMILES | CCN/C(=N\CCc1ccc(F)c(Br)c1)NCCc1cccc(C(=O)NC)c1.I |
| InChI | InChI=1S/C21H26BrFN4O.HI/c1-3-25-21(27-12-10-16-7-8-19(23)18(22)14-16)26-11-9-15-5-4-6-17(13-15)20(28)24-2;/h4-8,13-14H,3,9-12H2,1-2H3,(H,24,28)(H2,25,26,27);1H |
| InChIKey | SYYKNYOECQNDTJ-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.28 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|