C17H26F3IN4O2 — CID 111839446
1-[2-(1,3-benzodioxol-5-yl)ethyl]-3-ethyl-2-[2-[methyl(2,2,2-trifluoroethyl)amino]ethyl]guanidine;hydroiodide (PubChem CID 111839446) has the molecular formula C17H26F3IN4O2 and a molecular weight of 502.32 g/mol. Its IUPAC name is 1-[2-(1,3-benzodioxol-5-yl)ethyl]-3-ethyl-2-[2-[methyl(2,2,2-trifluoroethyl)amino]ethyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(1,3-benzodioxol-5-yl)ethyl]-3-ethyl-2-[2-[methyl(2,2,2-trifluoroethyl)amino]ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111839446 |
| Molecular Formula | C17H26F3IN4O2 |
| Molecular Weight | 502.32 g/mol |
| Exact Mass | 502.11 |
| IUPAC Name | 1-[2-(1,3-benzodioxol-5-yl)ethyl]-3-ethyl-2-[2-[methyl(2,2,2-trifluoroethyl)amino]ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCN(C)CC(F)(F)F)NCCc1ccc2c(c1)OCO2.I |
| InChI | InChI=1S/C17H25F3N4O2.HI/c1-3-21-16(23-8-9-24(2)11-17(18,19)20)22-7-6-13-4-5-14-15(10-13)26-12-25-14;/h4-5,10H,3,6-9,11-12H2,1-2H3,(H2,21,22,23);1H |
| InChIKey | JSLHMSDKTCWOEP-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.32 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|