C17H24F3IN4O3 — CID 111501488
2-[[[2-(1,3-benzodioxol-5-yl)ethylamino]-(ethylamino)methylidene]amino]-N-methyl-N-(2,2,2-trifluoroethyl)acetamide;hydroiodide (PubChem CID 111501488) has the molecular formula C17H24F3IN4O3 and a molecular weight of 516.30 g/mol. Its IUPAC name is 2-[[[2-(1,3-benzodioxol-5-yl)ethylamino]-(ethylamino)methylidene]amino]-N-methyl-N-(2,2,2-trifluoroethyl)acetamide;hydroiodide.
| Compound Name | 2-[[[2-(1,3-benzodioxol-5-yl)ethylamino]-(ethylamino)methylidene]amino]-N-methyl-N-(2,2,2-trifluoroethyl)acetamide;hydroiodide |
|---|---|
| PubChem CID | 111501488 |
| Molecular Formula | C17H24F3IN4O3 |
| Molecular Weight | 516.30 g/mol |
| Exact Mass | 516.08 |
| IUPAC Name | 2-[[[2-(1,3-benzodioxol-5-yl)ethylamino]-(ethylamino)methylidene]amino]-N-methyl-N-(2,2,2-trifluoroethyl)acetamide;hydroiodide |
| SMILES | CCN/C(=N\CC(=O)N(C)CC(F)(F)F)NCCc1ccc2c(c1)OCO2.I |
| InChI | InChI=1S/C17H23F3N4O3.HI/c1-3-21-16(23-9-15(25)24(2)10-17(18,19)20)22-7-6-12-4-5-13-14(8-12)27-11-26-13;/h4-5,8H,3,6-7,9-11H2,1-2H3,(H2,21,22,23);1H |
| InChIKey | OHBSKRMVSYQVLA-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.30 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|