C16H22F4N4O — CID 111501577
2-[[ethylamino-[2-(3-fluorophenyl)ethylamino]methylidene]amino]-N-methyl-N-(2,2,2-trifluoroethyl)acetamide (PubChem CID 111501577) has the molecular formula C16H22F4N4O and a molecular weight of 362.37 g/mol. Its IUPAC name is 2-[[ethylamino-[2-(3-fluorophenyl)ethylamino]methylidene]amino]-N-methyl-N-(2,2,2-trifluoroethyl)acetamide.
| Compound Name | 2-[[ethylamino-[2-(3-fluorophenyl)ethylamino]methylidene]amino]-N-methyl-N-(2,2,2-trifluoroethyl)acetamide |
|---|---|
| PubChem CID | 111501577 |
| Molecular Formula | C16H22F4N4O |
| Molecular Weight | 362.37 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | 2-[[ethylamino-[2-(3-fluorophenyl)ethylamino]methylidene]amino]-N-methyl-N-(2,2,2-trifluoroethyl)acetamide |
| SMILES | CCN/C(=N\CC(=O)N(C)CC(F)(F)F)NCCc1cccc(F)c1 |
| InChI | InChI=1S/C16H22F4N4O/c1-3-21-15(22-8-7-12-5-4-6-13(17)9-12)23-10-14(25)24(2)11-16(18,19)20/h4-6,9H,3,7-8,10-11H2,1-2H3,(H2,21,22,23) |
| InChIKey | LNAIOOAQPZQJSP-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.37 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|