C22H36N4O3 — CID 111869500
3-[[[3-(cyclopropylmethoxy)propylamino]-(4-propan-2-yloxyanilino)methylidene]amino]-2,2-dimethylpropanamide (PubChem CID 111869500) has the molecular formula C22H36N4O3 and a molecular weight of 404.56 g/mol. Its IUPAC name is 3-[[[3-(cyclopropylmethoxy)propylamino]-(4-propan-2-yloxyanilino)methylidene]amino]-2,2-dimethylpropanamide.
| Compound Name | 3-[[[3-(cyclopropylmethoxy)propylamino]-(4-propan-2-yloxyanilino)methylidene]amino]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 111869500 |
| Molecular Formula | C22H36N4O3 |
| Molecular Weight | 404.56 g/mol |
| Exact Mass | 404.28 |
| IUPAC Name | 3-[[[3-(cyclopropylmethoxy)propylamino]-(4-propan-2-yloxyanilino)methylidene]amino]-2,2-dimethylpropanamide |
| SMILES | CC(C)Oc1ccc(N/C(=N/CC(C)(C)C(N)=O)NCCCOCC2CC2)cc1 |
| InChI | InChI=1S/C22H36N4O3/c1-16(2)29-19-10-8-18(9-11-19)26-21(25-15-22(3,4)20(23)27)24-12-5-13-28-14-17-6-7-17/h8-11,16-17H,5-7,12-15H2,1-4H3,(H2,23,27)(H2,24,25,26) |
| InChIKey | SPPRYGPTBFDDEE-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.56 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|