C23H35IN6O2 — CID 111860263
1-[3-(cyclopropylmethoxy)propyl]-2-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)-3-(4-propan-2-yloxyphenyl)guanidine;hydroiodide (PubChem CID 111860263) has the molecular formula C23H35IN6O2 and a molecular weight of 554.48 g/mol. Its IUPAC name is 1-[3-(cyclopropylmethoxy)propyl]-2-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)-3-(4-propan-2-yloxyphenyl)guanidine;hydroiodide.
| Compound Name | 1-[3-(cyclopropylmethoxy)propyl]-2-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)-3-(4-propan-2-yloxyphenyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111860263 |
| Molecular Formula | C23H35IN6O2 |
| Molecular Weight | 554.48 g/mol |
| Exact Mass | 554.19 |
| IUPAC Name | 1-[3-(cyclopropylmethoxy)propyl]-2-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)-3-(4-propan-2-yloxyphenyl)guanidine;hydroiodide |
| SMILES | CC(C)Oc1ccc(N/C(=N/Cc2nnc3n2CCC3)NCCCOCC2CC2)cc1.I |
| InChI | InChI=1S/C23H34N6O2.HI/c1-17(2)31-20-10-8-19(9-11-20)26-23(24-12-4-14-30-16-18-6-7-18)25-15-22-28-27-21-5-3-13-29(21)22;/h8-11,17-18H,3-7,12-16H2,1-2H3,(H2,24,25,26);1H |
| InChIKey | OETPCZKAUHPJBL-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 85.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.48 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|