C24H30IN5O3 — CID 111866613
2-[2-(1,3-benzodioxol-5-yl)ethyl]-1-(2-imidazol-1-ylethyl)-3-(4-propan-2-yloxyphenyl)guanidine;hydroiodide (PubChem CID 111866613) has the molecular formula C24H30IN5O3 and a molecular weight of 563.44 g/mol. Its IUPAC name is 2-[2-(1,3-benzodioxol-5-yl)ethyl]-1-(2-imidazol-1-ylethyl)-3-(4-propan-2-yloxyphenyl)guanidine;hydroiodide.
| Compound Name | 2-[2-(1,3-benzodioxol-5-yl)ethyl]-1-(2-imidazol-1-ylethyl)-3-(4-propan-2-yloxyphenyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111866613 |
| Molecular Formula | C24H30IN5O3 |
| Molecular Weight | 563.44 g/mol |
| Exact Mass | 563.14 |
| IUPAC Name | 2-[2-(1,3-benzodioxol-5-yl)ethyl]-1-(2-imidazol-1-ylethyl)-3-(4-propan-2-yloxyphenyl)guanidine;hydroiodide |
| SMILES | CC(C)Oc1ccc(N/C(=N/CCc2ccc3c(c2)OCO3)NCCn2ccnc2)cc1.I |
| InChI | InChI=1S/C24H29N5O3.HI/c1-18(2)32-21-6-4-20(5-7-21)28-24(27-12-14-29-13-11-25-16-29)26-10-9-19-3-8-22-23(15-19)31-17-30-22;/h3-8,11,13,15-16,18H,9-10,12,14,17H2,1-2H3,(H2,26,27,28);1H |
| InChIKey | JSTRGOMAZKXLJW-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.44 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|