C21H32IN5O4 — CID 111871774
1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-3-(2-imidazol-1-ylethyl)-2-[3-(2-methoxyethoxy)propyl]guanidine;hydroiodide (PubChem CID 111871774) has the molecular formula C21H32IN5O4 and a molecular weight of 545.42 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-3-(2-imidazol-1-ylethyl)-2-[3-(2-methoxyethoxy)propyl]guanidine;hydroiodide.
| Compound Name | 1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-3-(2-imidazol-1-ylethyl)-2-[3-(2-methoxyethoxy)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111871774 |
| Molecular Formula | C21H32IN5O4 |
| Molecular Weight | 545.42 g/mol |
| Exact Mass | 545.15 |
| IUPAC Name | 1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-3-(2-imidazol-1-ylethyl)-2-[3-(2-methoxyethoxy)propyl]guanidine;hydroiodide |
| SMILES | COCCOCCC/N=C(\NCCn1ccnc1)Nc1ccc2c(c1)OCCCO2.I |
| InChI | InChI=1S/C21H31N5O4.HI/c1-27-14-15-28-11-2-6-23-21(24-8-10-26-9-7-22-17-26)25-18-4-5-19-20(16-18)30-13-3-12-29-19;/h4-5,7,9,16-17H,2-3,6,8,10-15H2,1H3,(H2,23,24,25);1H |
| InChIKey | WBJWQWIJYXDACY-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 91.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.42 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|