C22H37N3O5 — CID 111871233
1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-3-[2-(2-methoxyethoxy)ethyl]-2-[3-(2-methylpropoxy)propyl]guanidine (PubChem CID 111871233) has the molecular formula C22H37N3O5 and a molecular weight of 423.55 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-3-[2-(2-methoxyethoxy)ethyl]-2-[3-(2-methylpropoxy)propyl]guanidine.
| Compound Name | 1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-3-[2-(2-methoxyethoxy)ethyl]-2-[3-(2-methylpropoxy)propyl]guanidine |
|---|---|
| PubChem CID | 111871233 |
| Molecular Formula | C22H37N3O5 |
| Molecular Weight | 423.55 g/mol |
| Exact Mass | 423.27 |
| IUPAC Name | 1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-3-[2-(2-methoxyethoxy)ethyl]-2-[3-(2-methylpropoxy)propyl]guanidine |
| SMILES | COCCOCCN/C(=N\CCCOCC(C)C)Nc1ccc2c(c1)OCCCO2 |
| InChI | InChI=1S/C22H37N3O5/c1-18(2)17-28-10-4-8-23-22(24-9-13-27-15-14-26-3)25-19-6-7-20-21(16-19)30-12-5-11-29-20/h6-7,16,18H,4-5,8-15,17H2,1-3H3,(H2,23,24,25) |
| InChIKey | FGISTNJFUIGXTB-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 82.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.55 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|