C20H33N3O4 — CID 111860608
1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-3-[3-(2-methoxyethoxy)propyl]-2-(2-methylpropyl)guanidine (PubChem CID 111860608) has the molecular formula C20H33N3O4 and a molecular weight of 379.50 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-3-[3-(2-methoxyethoxy)propyl]-2-(2-methylpropyl)guanidine.
| Compound Name | 1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-3-[3-(2-methoxyethoxy)propyl]-2-(2-methylpropyl)guanidine |
|---|---|
| PubChem CID | 111860608 |
| Molecular Formula | C20H33N3O4 |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.25 |
| IUPAC Name | 1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-3-[3-(2-methoxyethoxy)propyl]-2-(2-methylpropyl)guanidine |
| SMILES | COCCOCCCN/C(=N\CC(C)C)Nc1ccc2c(c1)OCCCO2 |
| InChI | InChI=1S/C20H33N3O4/c1-16(2)15-22-20(21-8-4-9-25-13-12-24-3)23-17-6-7-18-19(14-17)27-11-5-10-26-18/h6-7,14,16H,4-5,8-13,15H2,1-3H3,(H2,21,22,23) |
| InChIKey | ZNPQDIBLSJEQIG-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|