C22H37N3O6 — CID 111871955
1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2,3-bis[3-(2-methoxyethoxy)propyl]guanidine (PubChem CID 111871955) has the molecular formula C22H37N3O6 and a molecular weight of 439.55 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2,3-bis[3-(2-methoxyethoxy)propyl]guanidine.
| Compound Name | 1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2,3-bis[3-(2-methoxyethoxy)propyl]guanidine |
|---|---|
| PubChem CID | 111871955 |
| Molecular Formula | C22H37N3O6 |
| Molecular Weight | 439.55 g/mol |
| Exact Mass | 439.27 |
| IUPAC Name | 1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2,3-bis[3-(2-methoxyethoxy)propyl]guanidine |
| SMILES | COCCOCCC/N=C(\NCCCOCCOC)Nc1ccc2c(c1)OCCCO2 |
| InChI | InChI=1S/C22H37N3O6/c1-26-14-16-28-10-3-8-23-22(24-9-4-11-29-17-15-27-2)25-19-6-7-20-21(18-19)31-13-5-12-30-20/h6-7,18H,3-5,8-17H2,1-2H3,(H2,23,24,25) |
| InChIKey | HDRZEFDBVOLDEJ-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 91.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.55 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|